|
CAS#: 14394-26-4 Product: (1,1-Dimethyl-3-oxobutyl)phosphonic acid dimethyl ester No suppilers available for the product. |
| Name | (1,1-Dimethyl-3-oxobutyl)phosphonic acid dimethyl ester |
|---|---|
| Synonyms | 4-Dimethoxyphosphoryl-4-Methyl-Pentan-2-One; (1,1-Dimethyl-3-Oxobutyl)Phosphonic Acid Dimethyl Ester; Phosphonic Acid, (1,1-Dimethyl-3-Oxobutyl)-, Dimethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19 |
| CAS Registry Number | 14394-26-4 |
| SMILES | C(C([P](=O)(OC)OC)(C)C)C(=O)C |
| InChI | 1S/C8H17O4P/c1-7(9)6-8(2,3)13(10,11-4)12-5/h6H2,1-5H3 |
| InChIKey | MOMJYWJXUNIBGJ-UHFFFAOYSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.656°C at 760 mmHg (Cal.) |
| Flash point | 136.893°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,1-Dimethyl-3-oxobutyl)phosphonic acid dimethyl ester |