|
CAS#: 144-76-3 Product: [[4-[4-(Sulfinomethylamino)Phenyl]Sulfonylphenyl]Amino]Methanesulfinic Acid No suppilers available for the product. |
| Name | [[4-[4-(Sulfinomethylamino)Phenyl]Sulfonylphenyl]Amino]Methanesulfinic Acid |
|---|---|
| Synonyms | Methanesulfinic Acid, (Sulfonylbis(4,1-Phenyleneimino))Bis-; Aldesulfon |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2O6S3 |
| Molecular Weight | 404.47 |
| CAS Registry Number | 144-76-3 |
| SMILES | C1=CC(=CC=C1[S](C2=CC=C(C=C2)NC[S](O)=O)(=O)=O)NC[S](O)=O |
| InChI | 1S/C14H16N2O6S3/c17-23(18)9-15-11-1-5-13(6-2-11)25(21,22)14-7-3-12(4-8-14)16-10-24(19)20/h1-8,15-16H,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | NEDPPCHNEOMTJV-UHFFFAOYSA-N |
| Density | 1.753g/cm3 (Cal.) |
|---|---|
| Boiling point | 857.262°C at 760 mmHg (Cal.) |
| Flash point | 472.255°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [[4-[4-(Sulfinomethylamino)Phenyl]Sulfonylphenyl]Amino]Methanesulfinic Acid |