|
CAS#: 144092-64-8 Product: 3,4-Dimethyl-2-(Thiophen-2-Ylmethyl)Pyrano[6,5-c]Pyrazol-6-One No suppilers available for the product. |
| Name | 3,4-Dimethyl-2-(Thiophen-2-Ylmethyl)Pyrano[6,5-c]Pyrazol-6-One |
|---|---|
| Synonyms | 3,4-Dimethyl-2-(2-Thienylmethyl)Pyrano[6,5-C]Pyrazol-6-One; 3,4-Dimethyl-2-(2-Thienylmethyl)-6-Pyrano[6,5-C]Pyrazolone; Ha 23 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.31 |
| CAS Registry Number | 144092-64-8 |
| SMILES | C1=C(SC=C1)C[N]3N=C2OC(=O)C=C(C2=C3C)C |
| InChI | 1S/C13H12N2O2S/c1-8-6-11(16)17-13-12(8)9(2)15(14-13)7-10-4-3-5-18-10/h3-6H,7H2,1-2H3 |
| InChIKey | MUWZUEDYUHEAIU-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.968°C at 760 mmHg (Cal.) |
| Flash point | 239.842°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dimethyl-2-(Thiophen-2-Ylmethyl)Pyrano[6,5-c]Pyrazol-6-One |