Online Database of Chemicals from Around the World
|
CAS#: 144193-99-7 Product: 1-Ethoxy-2,2,3,3-Tetrafluoro-4,4-Dimethylcyclobutan-1-Ol No suppilers available for the product. |
| Name | 1-Ethoxy-2,2,3,3-Tetrafluoro-4,4-Dimethylcyclobutan-1-Ol |
|---|---|
| Synonyms | 1-Ethoxy-2,2,3,3-Tetrafluoro-4,4-Dimethyl-Cyclobutan-1-Ol; 1-Ethoxy-2,2,3,3-Tetrafluoro-4,4-Dimethyl-1-Cyclobutanol |
| Molecular Structure |  |
| Molecular Formula | C8H12F4O2 |
| Molecular Weight | 216.18 |
| CAS Registry Number | 144193-99-7 |
| SMILES | C(OC1(C(C(C1(C)C)(F)F)(F)F)O)C |
| InChI | 1S/C8H12F4O2/c1-4-14-8(13)5(2,3)6(9,10)7(8,11)12/h13H,4H2,1-3H3 |
| InChIKey | UUFSEJFQNIOPDR-UHFFFAOYSA-N |
| Density | 1.281g/cm3 (Cal.) |
|---|---|
| Boiling point | 182.368°C at 760 mmHg (Cal.) |
| Flash point | 92.716°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethoxy-2,2,3,3-Tetrafluoro-4,4-Dimethylcyclobutan-1-Ol |