|
CAS#: 1446-17-9 Product: Chloroquinine Phosphate No suppilers available for the product. |
| Name | Chloroquinine Phosphate |
|---|---|
| Synonyms | 3377 Rp; 7-Chloro-4-[(4'-Diethylamino-1-Methylbutyl)Amino]Quinoline Diphosphate; Aralen Diphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H29ClN3O4P |
| Molecular Weight | 417.87 |
| CAS Registry Number | 1446-17-9 |
| SMILES | C1=C2C(=CC(=C1)Cl)N=CC=C2NC(CCCN(CC)CC)C.O=[P](O)(O)O |
| InChI | 1S/C18H26ClN3.H3O4P/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;1-5(2,3)4/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);(H3,1,2,3,4) |
| InChIKey | AEUAEICGCMSYCQ-UHFFFAOYSA-N |
| Boiling point | 460.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 232.3°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Chloroquinine Phosphate |