|
CAS#: 1450-22-2 Product: 1-Methyl-1,1,2,2,2-Pentaphenyldisilane No suppilers available for the product. |
| Name | 1-Methyl-1,1,2,2,2-Pentaphenyldisilane |
|---|---|
| Synonyms | 1-Methyl-1,1,2,2,2-pentaphenyldisilane # |
| Molecular Structure | ![]() |
| Molecular Formula | C31H28Si2 |
| Molecular Weight | 456.73 |
| CAS Registry Number | 1450-22-2 |
| SMILES | c1(ccccc1)[Si](c2ccccc2)(c3ccccc3)[Si](c4ccccc4)(c5ccccc5)C |
| InChI | 1S/C31H28Si2/c1-32(27-17-7-2-8-18-27,28-19-9-3-10-20-28)33(29-21-11-4-12-22-29,30-23-13-5-14-24-30)31-25-15-6-16-26-31/h2-26H,1H3 |
| InChIKey | JRIPUGLQRTUKPL-UHFFFAOYSA-N |
| Density | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 517°C at 760 mmHg (Cal.) |
| Flash point | 244.928°C (Cal.) |
| Refractive index | 1.63 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-1,1,2,2,2-Pentaphenyldisilane |