|
CAS#: 14507-00-7 Product: 6-Hydroxyestriol No suppilers available for the product. |
| Name | 6-Hydroxyestriol |
|---|---|
| Synonyms | 6-Hydroxyestriol; 6Alpha-Hydroxyestriol; Estra-1,3,5(10)-Triene-3,6,16,17-Tetrol, (16Alpha,17Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 |
| CAS Registry Number | 14507-00-7 |
| SMILES | [C@@H]23CC(C1=C(C=CC(=C1)O)[C@H]2CC[C@]4([C@H]3C[C@@H](O)[C@@H]4O)C)O |
| InChI | 1S/C18H24O4/c1-18-5-4-11-10-3-2-9(19)6-13(10)15(20)7-12(11)14(18)8-16(21)17(18)22/h2-3,6,11-12,14-17,19-22H,4-5,7-8H2,1H3/t11-,12-,14+,15?,16-,17+,18+/m1/s1 |
| InChIKey | AAKRPOLRKWJRRV-ZVBAVIFISA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.169°C at 760 mmHg (Cal.) |
| Flash point | 244.006°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Hydroxyestriol |