Online Database of Chemicals from Around the World
|
CAS#: 145147-04-2 Product: N-(Dihydro-5',6-Dihydroxyspiro(4,8-Dioxatricyclo(5.1.0.0(3,5))Octane-2,2'(3'H)-Furan)-4'-Yl)-4,6-Dimethyl-2,4-Dodecadienamide No suppilers available for the product. |
| Name | N-(Dihydro-5',6-Dihydroxyspiro(4,8-Dioxatricyclo(5.1.0.0(3,5))Octane-2,2'(3'H)-Furan)-4'-Yl)-4,6-Dimethyl-2,4-Dodecadienamide |
|---|---|
| Synonyms | Aranorosinol A |
| Molecular Structure |  |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 |
| CAS Registry Number | 145147-04-2 |
| SMILES | C(C(/C=C(/C=C/C(=O)NC4=C(OC2(C1OC1C(O)C3OC23)C4)O)C)C)CCCCC |
| InChI | 1S/C23H33NO6/c1-4-5-6-7-8-13(2)11-14(3)9-10-16(25)24-15-12-23(30-22(15)27)20-18(28-20)17(26)19-21(23)29-19/h9-11,13,17-21,26-27H,4-8,12H2,1-3H3,(H,24,25)/b10-9+,14-11+ |
| InChIKey | FERAJBGUQHEQLL-QDCWQMMGSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 638.603°C at 760 mmHg (Cal.) |
| Flash point | 340.015°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Dihydro-5',6-Dihydroxyspiro(4,8-Dioxatricyclo(5.1.0.0(3,5))Octane-2,2'(3'H)-Furan)-4'-Yl)-4,6-Dimethyl-2,4-Dodecadienamide |