Online Database of Chemicals from Around the World
|
CAS#: 14529-33-0 Product: 1,1,1-Trifluoro-3-(2-Thienyl)Acetone No suppilers available for the product. |
| Name | 1,1,1-Trifluoro-3-(2-Thienyl)Acetone |
|---|---|
| Synonyms | 1,1,1-Trifluoro-3-(2-Thienyl)Propan-2-One; 1,1,1-Trifluoro-3-(2-Thienyl)Acetone; 1,1,1-Trifluoro-3-Thiophen-2-Yl-Propan-2-One |
| Molecular Structure |  |
| Molecular Formula | C7H5F3OS |
| Molecular Weight | 194.17 |
| CAS Registry Number | 14529-33-0 |
| EINECS | 238-552-1 |
| SMILES | C1=CC=C(CC(C(F)(F)F)=O)S1 |
| InChI | 1S/C7H5F3OS/c8-7(9,10)6(11)4-5-2-1-3-12-5/h1-3H,4H2 |
| InChIKey | NBKNXYCQJHKJEU-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 184.119°C at 760 mmHg (Cal.) |
| Flash point | 65.153°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trifluoro-3-(2-Thienyl)Acetone |