|
CAS#: 14543-31-8 Product: 2,4-Bis(Allyloxy)-6-Chloro-1,3,5-Triazine No suppilers available for the product. |
| Name | 2,4-Bis(Allyloxy)-6-Chloro-1,3,5-Triazine |
|---|---|
| Synonyms | 2,4-Diallyloxy-6-Chloro-1,3,5-Triazine; 2,4-Diallyloxy-6-Chloro-S-Triazine; 2,4-Bis(Allyloxy)-6-Chloro-1,3,5-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 |
| CAS Registry Number | 14543-31-8 |
| EINECS | 238-578-3 |
| SMILES | C(C=C)OC1=NC(=NC(=N1)Cl)OCC=C |
| InChI | 1S/C9H10ClN3O2/c1-3-5-14-8-11-7(10)12-9(13-8)15-6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | DGBZQPVIQOKMQQ-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.393°C at 760 mmHg (Cal.) |
| Flash point | 165.107°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis(Allyloxy)-6-Chloro-1,3,5-Triazine |