|
CAS#: 146145-22-4 Product: Phenyl (1R)-3-(4-Iodophenyl)-8-Methyl-8-Azabicyclo[3.2.1]Octane-2-Carboxylate No suppilers available for the product. |
| Name | Phenyl (1R)-3-(4-Iodophenyl)-8-Methyl-8-Azabicyclo[3.2.1]Octane-2-Carboxylate |
|---|---|
| Synonyms | (1R)-3-(4-Iodophenyl)-8-Methyl-8-Azabicyclo[3.2.1]Octane-2-Carboxylic Acid Phenyl Ester; Rti 122; Rti-122 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H22INO2 |
| Molecular Weight | 447.31 |
| CAS Registry Number | 146145-22-4 |
| SMILES | [C@H]12C(C(CC(CC1)N2C)C3=CC=C(C=C3)I)C(=O)OC4=CC=CC=C4 |
| InChI | 1S/C21H22INO2/c1-23-16-11-12-19(23)20(21(24)25-17-5-3-2-4-6-17)18(13-16)14-7-9-15(22)10-8-14/h2-10,16,18-20H,11-13H2,1H3/t16?,18?,19-,20?/m1/s1 |
| InChIKey | YGQAUDOSACJSSX-KZJURKFRSA-N |
| Density | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.692°C at 760 mmHg (Cal.) |
| Flash point | 253.586°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl (1R)-3-(4-Iodophenyl)-8-Methyl-8-Azabicyclo[3.2.1]Octane-2-Carboxylate |