| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Axon MedChem BV | Netherlands | Inquire | ||
|---|---|---|---|---|
![]() |
+31 (50) 311-8007 | |||
![]() |
order@axonmedchem.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | (2S)-2-Amino-2-(3,5-Dihydroxyphenyl)Acetic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-2-(3,5-Dihydroxyphenyl)Ethanoic Acid; Ncgc00024800-01; Tocris-0805 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 |
| CAS Registry Number | 146255-66-5 |
| SMILES | [C@H](N)(C1=CC(=CC(=C1)O)O)C(O)=O |
| InChI | 1S/C8H9NO4/c9-7(8(12)13)4-1-5(10)3-6(11)2-4/h1-3,7,10-11H,9H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | HOOWCUZPEFNHDT-ZETCQYMHSA-N |
| Density | 1.55g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.773°C at 760 mmHg (Cal.) |
| Flash point | 225.21°C (Cal.) |
| solubility | Soluble to 50 mM in water |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-2-(3,5-Dihydroxyphenyl)Acetic Acid |