|
CAS#: 146333-15-5 Product: (2,3-Dihydroxycyclohexyl) Dihydrogen Phosphate No suppilers available for the product. |
| Name | (2,3-Dihydroxycyclohexyl) Dihydrogen Phosphate |
|---|---|
| Synonyms | Cis-1,2,3-Cyclohexanetriol-1-Phosphate; 1,2,3-Cyclohexanetriol, 1-(Dihydrogen Phosphate), (1Alha,2Alpha,3Alpha)-; 1,2,3-Cyclohexanetriol-1-Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13O6P |
| Molecular Weight | 212.14 |
| CAS Registry Number | 146333-15-5 |
| SMILES | O=[P](OC1C(C(CCC1)O)O)(O)O |
| InChI | 1S/C6H13O6P/c7-4-2-1-3-5(6(4)8)12-13(9,10)11/h4-8H,1-3H2,(H2,9,10,11) |
| InChIKey | NBMXVMPPXJFUTI-UHFFFAOYSA-N |
| Density | 1.584g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.498°C at 760 mmHg (Cal.) |
| Flash point | 212.343°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,3-Dihydroxycyclohexyl) Dihydrogen Phosphate |