| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Organix Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (781) 932-4142 | |||
![]() |
sard@organixinc.com | |||
| Chemical manufacturer since 1986 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 3-[2-(Dimethylamino)Ethyl]-1-Methyl-1H-Indol-4-Ol |
|---|---|
| Synonyms | [1465-16-3]; 1-Methylpsilocin |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29 |
| CAS Registry Number | 1465-16-3 |
| SMILES | CN1C=C(C2=C1C=CC=C2O)CCN(C)C |
| InChI | 1S/C13H18N2O/c1-14(2)8-7-10-9-15(3)11-5-4-6-12(16)13(10)11/h4-6,9,16H,7-8H2,1-3H3 |
| InChIKey | MZZRFEIDRWKTKJ-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.6±32.0°C at 760 mmHg (Cal.) |
| Flash point | 185.8±25.1°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 10 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for 3-[2-(Dimethylamino)Ethyl]-1-Methyl-1H-Indol-4-Ol |