Online Database of Chemicals from Around the World
|
CAS#: 14664-96-1 Product: 2,5-Dichloro-4-(2-Iodoacetylamino)Phenyl Thiocyanate No suppilers available for the product. |
| Name | 2,5-Dichloro-4-(2-Iodoacetylamino)Phenyl Thiocyanate |
|---|---|
| Synonyms | N-(2,5-Dichloro-4-Thiocyanato-Phenyl)-2-Iodo-Acetamide; N-(2,5-Dichloro-4-Thiocyanato-Phenyl)-2-Iodo-Ethanamide; 2,5-Dichloro-4-(2-Iodoacetamido)Phenyl Thiocyanate |
| Molecular Structure |  |
| Molecular Formula | C9H5Cl2IN2OS |
| Molecular Weight | 387.02 |
| CAS Registry Number | 14664-96-1 |
| SMILES | C1=C(C(=CC(=C1NC(CI)=O)Cl)SC#N)Cl |
| InChI | 1S/C9H5Cl2IN2OS/c10-5-2-8(16-4-13)6(11)1-7(5)14-9(15)3-12/h1-2H,3H2,(H,14,15) |
| InChIKey | YKTRVOONKYSFDP-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dichloro-4-(2-Iodoacetylamino)Phenyl Thiocyanate |