|
CAS#: 146726-40-1 Product: 2-Methyl-2-Propanyl [(1R,2R)-2-Fluorocyclopropyl]Carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-Propanyl [(1R,2R)-2-Fluorocyclopropyl]Carbamate |
|---|---|
| Synonyms | tert-butyl ((1R,2R)-2-fluorocyclopropyl)carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14FNO2 |
| Molecular Weight | 175.20 |
| CAS Registry Number | 146726-40-1 |
| SMILES | F[C@@H]1C[C@H]1NC(=O)OC(C)(C)C |
| InChI | 1S/C8H14FNO2/c1-8(2,3)12-7(11)10-6-4-5(6)9/h5-6H,4H2,1-3H3,(H,10,11)/t5-,6-/m1/s1 |
| InChIKey | VWSDKMQGCVVQBV-PHDIDXHHSA-N |
| Density | 1.092g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.352°C at 760 mmHg (Cal.) |
| Flash point | 97.952°C (Cal.) |
| Refractive index | 1.444 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl [(1R,2R)-2-Fluorocyclopropyl]Carbamate |