| Aronis | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Acetone 4-Phenyl-3-Thiosemicarbazone |
|---|---|
| Synonyms | 3-(Isopropylideneamino)-1-Phenyl-Thiourea; 3-(Isopropylideneamino)-1-Phenylthiourea; Acetone, 4-Phenyl-3-Thiosemicarbazone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.29 |
| CAS Registry Number | 14673-56-4 |
| SMILES | C1=C(NC(NN=C(C)C)=S)C=CC=C1 |
| InChI | 1S/C10H13N3S/c1-8(2)12-13-10(14)11-9-6-4-3-5-7-9/h3-7H,1-2H3,(H2,11,13,14) |
| InChIKey | AYODCYOTZCCVLO-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.621°C at 760 mmHg (Cal.) |
| Flash point | 139.24°C (Cal.) |
| (1) | R. Venkatraman, A. T. Swesi and B. M. Yamin. Acetone 4-phenylthiosemicarbazone, Acta Cryst. (2005). E61, o3914-o3916 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Acetone 4-Phenyl-3-Thiosemicarbazone |