|
CAS#: 1468-27-5 Product: 4-Methyl-N-(Oxan-2-Ylidene)Benzenesulfonamide No suppilers available for the product. |
| Name | 4-Methyl-N-(Oxan-2-Ylidene)Benzenesulfonamide |
|---|---|
| Synonyms | (Ne)-4-Methyl-N-(Oxan-2-Ylidene)Benzenesulfonamide; 4-Methyl-N-(Oxan-2-Ylidene)Benzenesulfonamide; 4-Methyl-N-Tetrahydropyran-2-Ylidene-Benzenesulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 |
| CAS Registry Number | 1468-27-5 |
| SMILES | C1=CC(=CC=C1[S](=O)(=O)N=C2OCCCC2)C |
| InChI | 1S/C12H15NO3S/c1-10-5-7-11(8-6-10)17(14,15)13-12-4-2-3-9-16-12/h5-8H,2-4,9H2,1H3 |
| InChIKey | ZKHXUEGXMLYKSX-UHFFFAOYSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.719°C at 760 mmHg (Cal.) |
| Flash point | 186.471°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-N-(Oxan-2-Ylidene)Benzenesulfonamide |