|
CAS#: 1469-07-4 Product: Damotepine No suppilers available for the product. |
| Name | Damotepine |
|---|---|
| Synonyms | 1-(5,6-Dihydrobenzo[B][1]Benzothiepin-6-Yl)-N,N-Dimethyl-Methanamine Hydrochloride; 5,6-Dihydrobenzo[B][1]Benzothiepin-6-Ylmethyl-Dimethyl-Amine Hydrochloride; Dibenzo(B,F)Thiepin-10-Methanamine, N,N-Dimethyl-, Hydrochloride (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20ClNS |
| Molecular Weight | 305.86 |
| CAS Registry Number | 1469-07-4 (23247-39-4) |
| SMILES | [H+].C3=C2C(CC1=CC=CC=C1SC2=CC=C3)CN(C)C.[Cl-] |
| InChI | 1S/C17H19NS.ClH/c1-18(2)12-14-11-13-7-3-5-9-16(13)19-17-10-6-4-8-15(14)17;/h3-10,14H,11-12H2,1-2H3;1H |
| InChIKey | DVNROWSUNXGNHC-UHFFFAOYSA-N |
| Boiling point | 355°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Damotepine |