|
CAS#: 14696-33-4 Product: Kaur-15-En-17-Ol No suppilers available for the product. |
| Name | Kaur-15-En-17-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 |
| CAS Registry Number | 14696-33-4 |
| SMILES | OC/C4=C/[C@]13C[C@@H]4CC[C@@H]3[C@@]2(C)CCC[C@](C)(C)[C@@H]2CC1 |
| InChI | 1S/C20H32O/c1-18(2)8-4-9-19(3)16(18)7-10-20-11-14(5-6-17(19)20)15(12-20)13-21/h12,14,16-17,21H,4-11,13H2,1-3H3/t14-,16-,17+,19-,20+/m0/s1 |
| InChIKey | BYNLGAZDLCEGRX-LFWUDYNKSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.565°C at 760 mmHg (Cal.) |
| Flash point | 139.638°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Kaur-15-En-17-Ol |