|
CAS#: 14703-79-8 Product: 3-(Methylamino)-4-Nitrophenol No suppilers available for the product. |
| Name | 3-(Methylamino)-4-Nitrophenol |
|---|---|
| Synonyms | 3-Methylamino-4-Nitro-Phenol; 3-(Methylamino)-4-Nitrophenol; Phenol, 3-(Methylamino)-4-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 |
| CAS Registry Number | 14703-79-8 |
| SMILES | C1=C(O)C=CC(=C1NC)[N+]([O-])=O |
| InChI | 1S/C7H8N2O3/c1-8-6-4-5(10)2-3-7(6)9(11)12/h2-4,8,10H,1H3 |
| InChIKey | RLGZWWJLIPEADI-UHFFFAOYSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.069°C at 760 mmHg (Cal.) |
| Flash point | 186.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Methylamino)-4-Nitrophenol |