|
CAS#: 147202-90-2 Product: 7,7',8,8',11,11',12,12',15,15'-Decahydro-beta,psi-caroten-4-ol No suppilers available for the product. |
| Name | 7,7',8,8',11,11',12,12',15,15'-Decahydro-beta,psi-caroten-4-ol |
|---|---|
| Synonyms | 4-hydroxy |
| Molecular Structure | ![]() |
| Molecular Formula | C40H66O |
| Molecular Weight | 562.95 |
| CAS Registry Number | 147202-90-2 |
| SMILES | C/C1=C(\CCC(\C)=C\CCC(\C)=C\CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)[C@@](C)(C)CCC1O |
| InChI | 1S/C40H66O/c1-31(2)17-13-20-34(5)23-15-25-35(6)24-14-21-32(3)18-11-12-19-33(4)22-16-26-36(7)27-28-38-37(8)39(41)29-30-40(38,9)10/h17-19,23-24,26,39,41H,11-16,20-22,25,27-30H2,1-10H3/b32-18+,33-19+,34-23+,35-24+,36-26+ |
| InChIKey | BDXINRRWHRXUBH-QXOWSTTNSA-N |
| Density | 0.897g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.167°C at 760 mmHg (Cal.) |
| Flash point | 282.92°C (Cal.) |
| Refractive index | 1.504 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,7',8,8',11,11',12,12',15,15'-Decahydro-beta,psi-caroten-4-ol |