|
CAS#: 1474-74-4 Product: Diphosphoric Acid P1,P1-Diethyl-P2,P2-Dimethyl Ester No suppilers available for the product. |
| Name | Diphosphoric Acid P1,P1-Diethyl-P2,P2-Dimethyl Ester |
|---|---|
| Synonyms | Phosphoric Acid Dimethoxyphosphoryl Diethyl Ester; 4-01-00-01341 (Beilstein Handbook Reference); Brn 1713229 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16O7P2 |
| Molecular Weight | 262.14 |
| CAS Registry Number | 1474-74-4 |
| SMILES | C(O[P](O[P](=O)(OC)OC)(=O)OCC)C |
| InChI | 1S/C6H16O7P2/c1-5-11-15(8,12-6-2)13-14(7,9-3)10-4/h5-6H2,1-4H3 |
| InChIKey | BEZLAYYFGVADSA-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.2°C at 760 mmHg (Cal.) |
| Flash point | 102.366°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphosphoric Acid P1,P1-Diethyl-P2,P2-Dimethyl Ester |