|
CAS#: 147527-30-8 Product: (2,5-Diphosphonooxyphenyl) Dihydrogen Phosphate No suppilers available for the product. |
| Name | (2,5-Diphosphonooxyphenyl) Dihydrogen Phosphate |
|---|---|
| Synonyms | Benzene 1,2,4-Trisphosphate; Bzp3-1,2,4 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9O12P3 |
| Molecular Weight | 366.05 |
| CAS Registry Number | 147527-30-8 |
| SMILES | C1=C(C(=CC=C1O[P](=O)(O)O)O[P](=O)(O)O)O[P](=O)(O)O |
| InChI | 1S/C6H9O12P3/c7-19(8,9)16-4-1-2-5(17-20(10,11)12)6(3-4)18-21(13,14)15/h1-3H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15) |
| InChIKey | XPWCRVGWWKLQCK-UHFFFAOYSA-N |
| Density | 2.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 777.939°C at 760 mmHg (Cal.) |
| Flash point | 424.282°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,5-Diphosphonooxyphenyl) Dihydrogen Phosphate |