|
CAS#: 147666-81-7 Product: 3-(3,4-Dihydroxyphenyl)-6,8-Dihydroxyisochromen-1-One No suppilers available for the product. |
| Name | 3-(3,4-Dihydroxyphenyl)-6,8-Dihydroxyisochromen-1-One |
|---|---|
| Synonyms | 3-(3,4-Dihydroxyphenyl)-6,8-Dihydroxy-Isochromen-1-One; 3-(3,4-Dihydroxyphenyl)-6,8-Dihydroxy-1-Isochromenone; Thunberginol B |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 |
| CAS Registry Number | 147666-81-7 |
| SMILES | C1=C(C2=C(C=C1O)C=C(OC2=O)C3=CC(=C(C=C3)O)O)O |
| InChI | 1S/C15H10O6/c16-9-3-8-5-13(7-1-2-10(17)11(18)4-7)21-15(20)14(8)12(19)6-9/h1-6,16-19H |
| InChIKey | NHFGEHLUROYMEB-UHFFFAOYSA-N |
| Density | 1.655g/cm3 (Cal.) |
|---|---|
| Boiling point | 664.05°C at 760 mmHg (Cal.) |
| Flash point | 257.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,4-Dihydroxyphenyl)-6,8-Dihydroxyisochromen-1-One |