|
CAS#: 1477-07-2 Product: 1-(3-Methoxyphenyl)-N-[2-(3-Methoxyphenyl)Ethyl]-2-Propanamine No suppilers available for the product. |
| Name | 1-(3-Methoxyphenyl)-N-[2-(3-Methoxyphenyl)Ethyl]-2-Propanamine |
|---|---|
| Synonyms | MFCD00034837 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 |
| CAS Registry Number | 1477-07-2 |
| SMILES | O(c1cc(ccc1)CCNC(C)Cc2cccc(OC)c2)C |
| InChI | 1S/C19H25NO2/c1-15(12-17-7-5-9-19(14-17)22-3)20-11-10-16-6-4-8-18(13-16)21-2/h4-9,13-15,20H,10-12H2,1-3H3 |
| InChIKey | PHMFTYHRSAOLLV-UHFFFAOYSA-N |
| Density | 1.034g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.398°C at 760 mmHg (Cal.) |
| Flash point | 186.233°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(3-Methoxyphenyl)-N-[2-(3-Methoxyphenyl)Ethyl]-2-Propanamine |