|
CAS#: 14788-97-7 Product: Bis(1,2,2-Trichloroethyl)Sulphoxide No suppilers available for the product. |
| Name | Bis(1,2,2-Trichloroethyl)Sulphoxide |
|---|---|
| Synonyms | Ai3-27220; Brn 1869466; Chemagro 4922 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4Cl6OS |
| Molecular Weight | 312.85 |
| CAS Registry Number | 14788-97-7 |
| SMILES | O=[S](C(C(Cl)Cl)Cl)C(C(Cl)Cl)Cl |
| InChI | 1S/C4H4Cl6OS/c5-1(6)3(9)12(11)4(10)2(7)8/h1-4H |
| InChIKey | VAVXWXRPWYSVME-UHFFFAOYSA-N |
| Density | 1.799g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.298°C at 760 mmHg (Cal.) |
| Flash point | 177.145°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(1,2,2-Trichloroethyl)Sulphoxide |