|
CAS#: 148-07-2 Product: (E)-4-[3,4-Bis(4-Chlorophenyl)Butan-2-Ylamino]-4-Oxobut-2-Enoic Acid No suppilers available for the product. |
| Name | (E)-4-[3,4-Bis(4-Chlorophenyl)Butan-2-Ylamino]-4-Oxobut-2-Enoic Acid |
|---|---|
| Synonyms | (E)-4-[[2,3-Bis(4-Chlorophenyl)-1-Methyl-Propyl]Amino]-4-Oxo-But-2-Enoic Acid; (E)-4-[[2,3-Bis(4-Chlorophenyl)-1-Methylpropyl]Amino]-4-Oxobut-2-Enoic Acid; (E)-4-[[2,3-Bis(4-Chlorophenyl)-1-Methyl-Propyl]Amino]-4-Keto-But-2-Enoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H19Cl2NO3 |
| Molecular Weight | 392.28 |
| CAS Registry Number | 148-07-2 |
| SMILES | C2=C(C(CC1=CC=C(Cl)C=C1)C(NC(\C=C\C(O)=O)=O)C)C=CC(=C2)Cl |
| InChI | 1S/C20H19Cl2NO3/c1-13(23-19(24)10-11-20(25)26)18(15-4-8-17(22)9-5-15)12-14-2-6-16(21)7-3-14/h2-11,13,18H,12H2,1H3,(H,23,24)(H,25,26)/b11-10+ |
| InChIKey | NKPCAAMLVDTZOB-ZHACJKMWSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.396°C at 760 mmHg (Cal.) |
| Flash point | 313.884°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-4-[3,4-Bis(4-Chlorophenyl)Butan-2-Ylamino]-4-Oxobut-2-Enoic Acid |