|
CAS#: 14813-29-7 Product: Myricetin hexaacetate No suppilers available for the product. |
| Name | Myricetin hexaacetate |
|---|---|
| Synonyms | [5,7-Diacetoxy-4-Oxo-2-(3,4,5-Triacetoxyphenyl)Chromen-3-Yl] Acetate; Acetic Acid [5,7-Diacetoxy-4-Oxo-2-(3,4,5-Triacetoxyphenyl)-3-Chromenyl] Ester; Acetic Acid [5,7-Diacetoxy-4-Keto-2-(3,4,5-Triacetoxyphenyl)Chromen-3-Yl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C27H22O14 |
| Molecular Weight | 570.46 |
| CAS Registry Number | 14813-29-7 |
| SMILES | C1=C(OC(=O)C)C=C(OC(=O)C)C2=C1OC(=C(OC(=O)C)C2=O)C3=CC(=C(OC(=O)C)C(=C3)OC(=O)C)OC(=O)C |
| InChI | 1S/C27H22O14/c1-11(28)35-18-9-19(36-12(2)29)23-20(10-18)41-25(27(24(23)34)40-16(6)33)17-7-21(37-13(3)30)26(39-15(5)32)22(8-17)38-14(4)31/h7-10H,1-6H3 |
| InChIKey | QBFUXEWYAKYOPN-UHFFFAOYSA-N |
| Density | 1.48g/cm3 (Cal.) |
|---|---|
| Boiling point | 716.2°C at 760 mmHg (Cal.) |
| Flash point | 302.018°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Myricetin hexaacetate |