|
CAS#: 1482-03-7 Product: 1,2,3,4,7,7-Hexafluorobicyclo[2.2.1]Hept-2-Ene No suppilers available for the product. |
| Name | 1,2,3,4,7,7-Hexafluorobicyclo[2.2.1]Hept-2-Ene |
|---|---|
| Synonyms | 1,2,3,4,7,7-HEXAFLUOROBICYCLO(2.2.1)HEPT-2-ENE; 1,2,3,4,7,7-Hexafluorobicyclo[2.2.1]hept-2-ene # |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4F6 |
| Molecular Weight | 202.10 |
| CAS Registry Number | 1482-03-7 |
| SMILES | FC2(F)C1(F)C(\F)=C(\F)C2(F)CC1 |
| InChI | 1S/C7H4F6/c8-3-4(9)6(11)2-1-5(3,10)7(6,12)13/h1-2H2 |
| InChIKey | WOQNGFSORPSJFQ-UHFFFAOYSA-N |
| Density | 1.523g/cm3 (Cal.) |
|---|---|
| Boiling point | 108.389°C at 760 mmHg (Cal.) |
| Flash point | 21.736°C (Cal.) |
| Refractive index | 1.378 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,7,7-Hexafluorobicyclo[2.2.1]Hept-2-Ene |