Online Database of Chemicals from Around the World
|
CAS#: 14825-93-5 Product: N-(2,2,2-Trichloro-1-Hydroxyethyl)Methacrylamide No suppilers available for the product. |
| Name | N-(2,2,2-Trichloro-1-Hydroxyethyl)Methacrylamide |
|---|---|
| Synonyms | 2-Methyl-N-(2,2,2-Trichloro-1-Hydroxy-Ethyl)Prop-2-Enamide; 2-Methyl-N-(2,2,2-Trichloro-1-Hydroxy-Ethyl)Acrylamide |
| Molecular Structure |  |
| Molecular Formula | C6H8Cl3NO2 |
| Molecular Weight | 232.49 |
| CAS Registry Number | 14825-93-5 |
| EINECS | 238-895-7 |
| SMILES | CC(C(=O)NC(O)C(Cl)(Cl)Cl)=C |
| InChI | 1S/C6H8Cl3NO2/c1-3(2)4(11)10-5(12)6(7,8)9/h5,12H,1H2,2H3,(H,10,11) |
| InChIKey | HYIOVDDWOCTHOG-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.055°C at 760 mmHg (Cal.) |
| Flash point | 161.879°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,2,2-Trichloro-1-Hydroxyethyl)Methacrylamide |