Online Database of Chemicals from Around the World
|
CAS#: 14835-94-0 Product: 1-Chloro-2-(2-Chloro-1-(4-Chlorophenyl)Ethenyl)-Benzene No suppilers available for the product. |
| Name | 1-Chloro-2-(2-Chloro-1-(4-Chlorophenyl)Ethenyl)-Benzene |
|---|---|
| Synonyms | 1-Chloro-4-[(E)-2-Chloro-1-(2-Chlorophenyl)Ethenyl]Benzene; 1-Chloro-4-[2-Chloro-1-(2-Chlorophenyl)Vinyl]Benzene; 1-Chloro-4-[(E)-2-Chloro-1-(2-Chlorophenyl)Vinyl]Benzene |
| Molecular Structure |  |
| Molecular Formula | C14H9Cl3 |
| Molecular Weight | 283.58 |
| CAS Registry Number | 14835-94-0 (25394-54-1) |
| SMILES | C1=CC(=CC=C1Cl)\C(C2=C(Cl)C=CC=C2)=C/Cl |
| InChI | 1S/C14H9Cl3/c15-9-13(10-5-7-11(16)8-6-10)12-3-1-2-4-14(12)17/h1-9H/b13-9+ |
| InChIKey | OQMWNKDFIAFJEO-UKTHLTGXSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.874°C at 760 mmHg (Cal.) |
| Flash point | 262.43°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2-(2-Chloro-1-(4-Chlorophenyl)Ethenyl)-Benzene |