|
CAS#: 14846-40-3 Product: Tetrakis(1-Methylethyl)Plumbane No suppilers available for the product. |
| Name | Tetrakis(1-Methylethyl)Plumbane |
|---|---|
| Synonyms | Tetraisopropylplumbane; Plumbane, Tetrakis(1-Methylethyl)-; Tetraisopropyllead |
| Molecular Structure | ![]() |
| Molecular Formula | C12H28Pb |
| Molecular Weight | 379.55 |
| CAS Registry Number | 14846-40-3 |
| SMILES | CC([Pb](C(C)C)(C(C)C)C(C)C)C |
| InChI | 1S/4C3H7.Pb/c4*1-3-2;/h4*3H,1-2H3; |
| InChIKey | DMTMQVNOOBTJCV-UHFFFAOYSA-N |
| Boiling point | 271.685°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 118.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrakis(1-Methylethyl)Plumbane |