|
CAS#: 1486-20-0 Product: Tetrakis(Trifluoromethyl)Diphosphathiane No suppilers available for the product. |
| Name | Tetrakis(Trifluoromethyl)Diphosphathiane |
|---|---|
| Synonyms | 1,1,3,3-Tetrakis(trifluoromethyl)diphosphathiane #; Bis(ditrifluoromethyldiphosphino) sulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C4F12P2S |
| Molecular Weight | 370.04 |
| CAS Registry Number | 1486-20-0 |
| SMILES | FC(F)(F)P(SP(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C4F12P2S/c5-1(6,7)17(2(8,9)10)19-18(3(11,12)13)4(14,15)16 |
| InChIKey | ULASFWIFQPWNDN-UHFFFAOYSA-N |
| Boiling point | 70.711°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | -3.433°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrakis(Trifluoromethyl)Diphosphathiane |