|
CAS#: 14865-38-4 Product: 2-Methyl-Benzenemethanamine hydrochloride No suppilers available for the product. |
| Name | 2-Methyl-Benzenemethanamine hydrochloride |
|---|---|
| Synonyms | O-Tolylmethylammonium Chloride; (2-Methylbenzyl)Ammonium Chloride; Benzylamine, O-Methyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 |
| CAS Registry Number | 14865-38-4 |
| SMILES | C1=C(C(=CC=C1)C)C[NH3+].[Cl-] |
| InChI | 1S/C8H11N.ClH/c1-7-4-2-3-5-8(7)6-9;/h2-5H,6,9H2,1H3;1H |
| InChIKey | AFUROYYNHZQQOL-UHFFFAOYSA-N |
| Boiling point | 203.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 83.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-Benzenemethanamine hydrochloride |