|
CAS#: 14876-25-6 Product: 2-(4-Amino-N-Ethyl-M-Toluidino)Ethanol Nitrate No suppilers available for the product. |
| Name | 2-(4-Amino-N-Ethyl-M-Toluidino)Ethanol Nitrate |
|---|---|
| Synonyms | 2-[(4-Amino-3-Methyl-Phenyl)-Ethyl-Amino]Ethanol; Nitric Acid; 2-(4-Amino-N-Ethyl-M-Toluidino)Ethanol Nitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 |
| CAS Registry Number | 14876-25-6 |
| EINECS | 238-950-5 |
| SMILES | C1=C(C(=CC=C1N(CCO)CC)N)C.O=[N+]([O-])O |
| InChI | 1S/C11H18N2O.HNO3/c1-3-13(6-7-14)10-4-5-11(12)9(2)8-10;2-1(3)4/h4-5,8,14H,3,6-7,12H2,1-2H3;(H,2,3,4) |
| InChIKey | XJHFXNXVOUMVLF-UHFFFAOYSA-N |
| Boiling point | 364.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Amino-N-Ethyl-M-Toluidino)Ethanol Nitrate |