Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 1-[(Acetylcarbamoyl)Amino]Cyclopropanecarboxylate |
|---|---|
| Synonyms | methyl 1-(3-acetylureido)cyclopropanecarboxylate |
| Molecular Structure | ![CAS#: 148930-73-8, Methyl 1-[(Acetylcarbamoyl)Amino]Cyclopropanecarboxylate](/moreStructures/148930-73-8.gif) |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 148930-73-8 |
| SMILES | CC(=O)NC(=O)NC1(CC1)C(=O)OC |
| InChI | 1S/C8H12N2O4/c1-5(11)9-7(13)10-8(3-4-8)6(12)14-2/h3-4H2,1-2H3,(H2,9,10,11,13) |
| InChIKey | NODLQRSEQRNNPY-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1-[(Acetylcarbamoyl)Amino]Cyclopropanecarboxylate |