Online Database of Chemicals from Around the World
| Name | Benzo[h][1]Benzothieno[3,2-b]Quinoline |
|---|---|
| Synonyms | Benzo(H)(1)Benzothieno(3,2-B)Quinoline; Naphtho(2,1-E)Thianaphtheno(3,2-B)Pyridine |
| Molecular Structure | ![CAS#: 1491-09-4, Benzo[h][1]Benzothieno[3,2-b]Quinoline](/moreStructures/1491-09-4.gif) |
| Molecular Formula | C19H11NS |
| Molecular Weight | 285.36 |
| CAS Registry Number | 1491-09-4 |
| SMILES | C1=C4C(=NC2=C1SC3=CC=CC=C23)C5=C(C=C4)C=CC=C5 |
| InChI | 1S/C19H11NS/c1-2-6-14-12(5-1)9-10-13-11-17-19(20-18(13)14)15-7-3-4-8-16(15)21-17/h1-11H |
| InChIKey | GLEGLXQUFHLTRQ-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.194°C at 760 mmHg (Cal.) |
| Flash point | 266.594°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[h][1]Benzothieno[3,2-b]Quinoline |
