|
CAS#: 149194-25-2 Product: N'-(2-Chloroethyl)-N,N'-Bis(Methylsulfonyl)Acetohydrazide No suppilers available for the product. |
| Name | N'-(2-Chloroethyl)-N,N'-Bis(Methylsulfonyl)Acetohydrazide |
|---|---|
| Synonyms | N'-(2-Chloroethyl)-N,N'-Dimesyl-Acetohydrazide; N'-(2-Chloroethyl)-N,N'-Bis(Methylsulfonyl)Ethanehydrazide; 1-Ac-Bis(Meso2)Ceh |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13ClN2O5S2 |
| Molecular Weight | 292.75 |
| CAS Registry Number | 149194-25-2 |
| SMILES | C(N([S](=O)(=O)C)N([S](=O)(=O)C)C(=O)C)CCl |
| InChI | 1S/C6H13ClN2O5S2/c1-6(10)9(16(3,13)14)8(5-4-7)15(2,11)12/h4-5H2,1-3H3 |
| InChIKey | ZMDLBLZFZSHVLH-UHFFFAOYSA-N |
| Density | 1.52g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.779°C at 760 mmHg (Cal.) |
| Flash point | 205.256°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-(2-Chloroethyl)-N,N'-Bis(Methylsulfonyl)Acetohydrazide |