|
CAS#: 14925-75-8 Product: (2-Prop-2-Enylphenyl) Prop-2-Enoate No suppilers available for the product. |
| Name | (2-Prop-2-Enylphenyl) Prop-2-Enoate |
|---|---|
| Synonyms | (2-Allylphenyl) Prop-2-Enoate; Prop-2-Enoic Acid (2-Allylphenyl) Ester; Acrylic Acid (2-Allylphenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 |
| CAS Registry Number | 14925-75-8 |
| SMILES | C1=C(OC(=O)C=C)C(=CC=C1)CC=C |
| InChI | 1S/C12H12O2/c1-3-7-10-8-5-6-9-11(10)14-12(13)4-2/h3-6,8-9H,1-2,7H2 |
| InChIKey | MVHITVMIKXLDKZ-UHFFFAOYSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.577°C at 760 mmHg (Cal.) |
| Flash point | 117.563°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Prop-2-Enylphenyl) Prop-2-Enoate |