|
CAS#: 14985-83-2 Product: 2,2-Dichloro-N-(2-Methylphenyl)Acetamide No suppilers available for the product. |
| Name | 2,2-Dichloro-N-(2-Methylphenyl)Acetamide |
|---|---|
| Synonyms | 2,2-Dichloro-N-(2-Methylphenyl)Ethanamide; Nsc52551 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 |
| CAS Registry Number | 14985-83-2 |
| SMILES | C1=CC=CC(=C1NC(C(Cl)Cl)=O)C |
| InChI | 1S/C9H9Cl2NO/c1-6-4-2-3-5-7(6)12-9(13)8(10)11/h2-5,8H,1H3,(H,12,13) |
| InChIKey | AYWNNBNZROXRBJ-UHFFFAOYSA-N |
| Density | 1.347g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.221°C at 760 mmHg (Cal.) |
| Flash point | 154.722°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-N-(2-Methylphenyl)Acetamide |