|
CAS#: 149879-61-8 Product: 1-{[4-Methyl-3-(Tributylstannyl)Benzoyl]Oxy}-2,5-Pyrrolidinedione No suppilers available for the product. |
| Name | 1-{[4-Methyl-3-(Tributylstannyl)Benzoyl]Oxy}-2,5-Pyrrolidinedione |
|---|---|
| Synonyms | N-succinimidyl 4-methyl-3-(tri-n-butylstannyl)benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H37NO4Sn |
| Molecular Weight | 522.26 |
| CAS Registry Number | 149879-61-8 |
| SMILES | O=C2CCC(=O)N2OC(=O)c1cc(c(C)cc1)[Sn](CCCC)(CCCC)CCCC |
| InChI | 1S/C12H10NO4.3C4H9.Sn/c1-8-2-4-9(5-3-8)12(16)17-13-10(14)6-7-11(13)15;3*1-3-4-2;/h2,4-5H,6-7H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | DAXDOMMZVPHVBA-UHFFFAOYSA-N |
| Boiling point | 547.38°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 284.845°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{[4-Methyl-3-(Tributylstannyl)Benzoyl]Oxy}-2,5-Pyrrolidinedione |