|
CAS#: 14997-54-7 Product: Guanosine 5'-(alpha,beta-methylene)triphosphate No suppilers available for the product. |
| Name | Guanosine 5'-(alpha,beta-methylene)triphosphate |
|---|---|
| Synonyms | Phosphomethylphosphonic Acid-Guanylate Ester; Gcp; Gabmtp |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18N5O13P3 |
| Molecular Weight | 521.21 |
| CAS Registry Number | 14997-54-7 |
| SMILES | [P](OC[C@H]3O[C@@H]([N]1C2=C(N=C1)C(=O)N=C(N2)N)[C@H](O)[C@@H]3O)(O[P](O)(=O)C[P](O)(O)=O)(O)=O |
| InChI | 1S/C11H18N5O13P3/c12-11-14-8-5(9(19)15-11)13-2-16(8)10-7(18)6(17)4(28-10)1-27-32(25,26)29-31(23,24)3-30(20,21)22/h2,4,6-7,10,17-18H,1,3H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | PHBDHXOBFUBCJD-KQYNXXCUSA-N |
| Density | 2.616g/cm3 (Cal.) |
|---|---|
| Boiling point | 1043.871°C at 760 mmHg (Cal.) |
| Flash point | 585.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Guanosine 5'-(alpha,beta-methylene)triphosphate |