|
CAS#: 15012-53-0 Product: 2-Ethyl-5,8-Dihydroxy-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2-Ethyl-5,8-Dihydroxy-1,4-Naphthoquinone |
|---|---|
| Synonyms | 1,4-Naphthoquinone, 6-ethyl-5,8-dihydroxy-; 2-Ethyl-5,8-dihydroxynaphthoquinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 15012-53-0 |
| SMILES | O=C\2c1c(O)ccc(O)c1C(=O)/C(=C/2)CC |
| InChI | 1S/C12H10O4/c1-2-6-5-9(15)10-7(13)3-4-8(14)11(10)12(6)16/h3-5,13-14H,2H2,1H3 |
| InChIKey | FBDSXHWBGHODGZ-UHFFFAOYSA-N |
| Density | 1.408g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.979°C at 760 mmHg (Cal.) |
| Flash point | 260.003°C (Cal.) |
| Refractive index | 1.642 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-5,8-Dihydroxy-1,4-Naphthoquinone |