| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5,8-Dimethoxy-1,4-Naphthalenedione |
|---|---|
| Synonyms | 5,8-Dimethoxy-1,4-Naphthoquinone; 1,4-Naphthalenedione, 5,8-Dimethoxy-; 1,4-Naphthoquinone, 5,8-Dimethoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 15013-16-8 |
| SMILES | C2=C(C1=C(C(C=CC1=O)=O)C(=C2)OC)OC |
| InChI | 1S/C12H10O4/c1-15-9-5-6-10(16-2)12-8(14)4-3-7(13)11(9)12/h3-6H,1-2H3 |
| InChIKey | HXULXWJWZVUESP-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.405°C at 760 mmHg (Cal.) |
| Flash point | 188.843°C (Cal.) |
| (1) | Arnone Alberto, Merlini Lucio, Nasini Gianluca, de Pava Orso Vajna. Direct Amination of Naphthazarin, Juglone, and Some Derivatives, Synthetic Communications, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,8-Dimethoxy-1,4-Naphthalenedione |