|
CAS#: 15028-44-1 Product: Methyl 3-Phenyl-DL-Alaninate No suppilers available for the product. |
| Name | Methyl 3-Phenyl-DL-Alaninate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H14NO2 |
| Molecular Weight | 180.23 |
| CAS Registry Number | 15028-44-1 |
| EINECS | 239-109-5 |
| SMILES | [C@H]([NH3+])(C(OC)=O)CC1=CC=CC=C1 |
| InChI | 1S/C10H13NO2/c1-13-10(12)9(11)7-8-5-3-2-4-6-8/h2-6,9H,7,11H2,1H3/p+1/t9-/m1/s1 |
| InChIKey | VSDUZFOSJDMAFZ-SECBINFHSA-O |
| Boiling point | 264.166°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 126.033°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-Phenyl-DL-Alaninate |