|
CAS#: 1503-91-9 Product: N-Hydroxy-4-Chloroacetanilide No suppilers available for the product. |
| Name | N-Hydroxy-4-Chloroacetanilide |
|---|---|
| Synonyms | N-(4-Chlorophenyl)-N-Hydroxy-Acetamide; N-(4-Chlorophenyl)-N-Hydroxy-Ethanamide; Acetamide, N-(4-Chlorophenyl)-N-Hydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 |
| CAS Registry Number | 1503-91-9 |
| SMILES | C1=CC(=CC=C1N(C(C)=O)O)Cl |
| InChI | 1S/C8H8ClNO2/c1-6(11)10(12)8-4-2-7(9)3-5-8/h2-5,12H,1H3 |
| InChIKey | CDIAYJXLIMKAJJ-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.779°C at 760 mmHg (Cal.) |
| Flash point | 149.011°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Hydroxy-4-Chloroacetanilide |