|
CAS#: 15063-64-6 Product: 1-Ethyl-1,1,2,2,2-Pentamethyldisilane No suppilers available for the product. |
| Name | 1-Ethyl-1,1,2,2,2-Pentamethyldisilane |
|---|---|
| Synonyms | Ethyl-Dimethyl-Trimethylsilyl-Silane; 1-Ethyl-1,1,2,2,2-Pentamethyldisilane; Disilane, Ethylpentamethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H20Si2 |
| Molecular Weight | 160.41 |
| CAS Registry Number | 15063-64-6 |
| SMILES | C([Si]([Si](C)(C)C)(C)C)C |
| InChI | 1S/C7H20Si2/c1-7-9(5,6)8(2,3)4/h7H2,1-6H3 |
| InChIKey | AIYNVZFMBDWFLW-UHFFFAOYSA-N |
| Density | 0.744g/cm3 (Cal.) |
|---|---|
| Boiling point | 137.613°C at 760 mmHg (Cal.) |
| Flash point | 20.054°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-1,1,2,2,2-Pentamethyldisilane |