|
CAS#: 150871-05-9 Product: N-[(Adamantan-2-Yloxy)Carbonyl]-alpha-Methyltryptophyl-N-[2-(4-Chlorophenyl)Ethyl]Glycine No suppilers available for the product. |
| Name | N-[(Adamantan-2-Yloxy)Carbonyl]-alpha-Methyltryptophyl-N-[2-(4-Chlorophenyl)Ethyl]Glycine |
|---|---|
| Synonyms | N-(N-((2- |
| Molecular Structure | ![]() |
| Molecular Formula | C33H38ClN3O5 |
| Molecular Weight | 592.12 |
| CAS Registry Number | 150871-05-9 |
| SMILES | Clc1ccc(cc1)CCN(C(=O)C(NC(=O)OC4C2CC3CC(C2)CC4C3)(C)Cc6c5ccccc5nc6)CC(=O)O |
| InChI | 1S/C33H38ClN3O5/c1-33(17-25-18-35-28-5-3-2-4-27(25)28,31(40)37(19-29(38)39)11-10-20-6-8-26(34)9-7-20)36-32(41)42-30-23-13-21-12-22(15-23)16-24(30)14-21/h2-9,18,21-24,30,35H,10-17,19H2,1H3,(H,36,41)(H,38,39) |
| InChIKey | LZZPPPZINPSHEI-UHFFFAOYSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 824.071°C at 760 mmHg (Cal.) |
| Flash point | 452.182°C (Cal.) |
| Refractive index | 1.657 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(Adamantan-2-Yloxy)Carbonyl]-alpha-Methyltryptophyl-N-[2-(4-Chlorophenyl)Ethyl]Glycine |