|
CAS#: 150929-88-7 Product: Trimethyl[(3-Methyl-1-Cyclohexen-1-Yl)Methyl]Silane No suppilers available for the product. |
| Name | Trimethyl[(3-Methyl-1-Cyclohexen-1-Yl)Methyl]Silane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 |
| CAS Registry Number | 150929-88-7 |
| SMILES | C\1=C(/C[Si](C)(C)C)CCCC/1C |
| InChI | 1S/C11H22Si/c1-10-6-5-7-11(8-10)9-12(2,3)4/h8,10H,5-7,9H2,1-4H3 |
| InChIKey | XZPQEUBTPDCCIS-UHFFFAOYSA-N |
| Density | 0.814g/cm3 (Cal.) |
|---|---|
| Boiling point | 209.06°C at 760 mmHg (Cal.) |
| Flash point | 67.391°C (Cal.) |
| Refractive index | 1.442 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl[(3-Methyl-1-Cyclohexen-1-Yl)Methyl]Silane |